C28H4F6N10O — CID 156623426
(2E)-2-[cyano(isocyano)methylidene]-5-[4-(7-fluoro-4-isocyano-1,3-benzoxazol-2-yl)-6-(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]benzimidazole-4-carbonitrile (PubChem CID 156623426) has the molecular formula C28H4F6N10O and a molecular weight of 610.40 g/mol. Its IUPAC name is (2E)-2-[cyano(isocyano)methylidene]-5-[4-(7-fluoro-4-isocyano-1,3-benzoxazol-2-yl)-6-(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]benzimidazole-4-carbonitrile.
| Compound Name | (2E)-2-[cyano(isocyano)methylidene]-5-[4-(7-fluoro-4-isocyano-1,3-benzoxazol-2-yl)-6-(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 156623426 |
| Molecular Formula | C28H4F6N10O |
| Molecular Weight | 610.40 g/mol |
| Exact Mass | 610.05 |
| IUPAC Name | (2E)-2-[cyano(isocyano)methylidene]-5-[4-(7-fluoro-4-isocyano-1,3-benzoxazol-2-yl)-6-(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]benzimidazole-4-carbonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\N=c2ccc(-c3nc(-c4nc5c([N+]#[C-])ccc(F)c5o4)nc(-c4c(F)c(F)c(F)c(F)c4F)n3)c(C#N)c2=N1 |
| InChI | InChI=1S/C28H4F6N10O/c1-37-12-6-4-11(29)23-22(12)41-28(45-23)27-43-24(42-26(44-27)15-16(30)18(32)20(34)19(33)17(15)31)9-3-5-13-21(10(9)7-35)40-25(39-13)14(8-36)38-2/h3-6H/b25-14+ |
| InChIKey | JGMOQLTYGVTXIH-AFUMVMLFSA-N |
| XLogP | 5.14 |
| TPSA | 145.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.40 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|