C19H17NO3 — CID 15662343
2-benzyl-8-methoxy-4,8b-dihydro-3aH-indeno[1,2-c]pyrrole-1,3-dione (PubChem CID 15662343) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-benzyl-8-methoxy-4,8b-dihydro-3aH-indeno[1,2-c]pyrrole-1,3-dione.
| Compound Name | 2-benzyl-8-methoxy-4,8b-dihydro-3aH-indeno[1,2-c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 15662343 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-benzyl-8-methoxy-4,8b-dihydro-3aH-indeno[1,2-c]pyrrole-1,3-dione |
| SMILES | COc1cccc2c1C1C(=O)N(Cc3ccccc3)C(=O)C1C2 |
| InChI | InChI=1S/C19H17NO3/c1-23-15-9-5-8-13-10-14-17(16(13)15)19(22)20(18(14)21)11-12-6-3-2-4-7-12/h2-9,14,17H,10-11H2,1H3 |
| InChIKey | HUTWAWCHUDELEE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|