C9H16N2O — CID 156623696
(3Z)-3-(3-aminopropylidene)-5,5-dimethylpyrrolidin-2-one (PubChem CID 156623696) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is (3Z)-3-(3-aminopropylidene)-5,5-dimethylpyrrolidin-2-one.
| Compound Name | (3Z)-3-(3-aminopropylidene)-5,5-dimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 156623696 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | (3Z)-3-(3-aminopropylidene)-5,5-dimethylpyrrolidin-2-one |
| SMILES | CC1(C)C/C(=C/CCN)C(=O)N1 |
| InChI | InChI=1S/C9H16N2O/c1-9(2)6-7(4-3-5-10)8(12)11-9/h4H,3,5-6,10H2,1-2H3,(H,11,12)/b7-4- |
| InChIKey | HMJGAXBXKHEEFE-DAXSKMNVSA-N |
| XLogP | 0.56 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|