C29H41N7O4SSi — CID 156623734
(14S)-12,12-dimethyl-2,2-dioxo-8-[3-(3-trimethylsilylpropoxy)pyrazol-1-yl]-2λ6-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one (PubChem CID 156623734) has the molecular formula C29H41N7O4SSi and a molecular weight of 611.85 g/mol. Its IUPAC name is (14S)-12,12-dimethyl-2,2-dioxo-8-[3-(3-trimethylsilylpropoxy)pyrazol-1-yl]-2λ6-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one.
| Compound Name | (14S)-12,12-dimethyl-2,2-dioxo-8-[3-(3-trimethylsilylpropoxy)pyrazol-1-yl]-2λ6-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one |
|---|---|
| PubChem CID | 156623734 |
| Molecular Formula | C29H41N7O4SSi |
| Molecular Weight | 611.85 g/mol |
| Exact Mass | 611.27 |
| IUPAC Name | (14S)-12,12-dimethyl-2,2-dioxo-8-[3-(3-trimethylsilylpropoxy)pyrazol-1-yl]-2λ6-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one |
| SMILES | CC1(C)C[C@@H]2CCCNc3cccc(n3)S(=O)(=O)NC(=O)c3ccc(-n4ccc(OCCC[Si](C)(C)C)n4)nc3N1C2 |
| InChI | InChI=1S/C29H41N7O4SSi/c1-29(2)19-21-9-7-15-30-23-10-6-11-26(31-23)41(38,39)34-28(37)22-12-13-24(32-27(22)35(29)20-21)36-16-14-25(33-36)40-17-8-18-42(3,4)5/h6,10-14,16,21H,7-9,15,17-20H2,1-5H3,(H,30,31)(H,34,37)/t21-/m0/s1 |
| InChIKey | CPRICNRKRQIEKW-NRFANRHFSA-N |
| XLogP | 4.70 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.85 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|