C27H37N7O4SSi — CID 156623746
(14S)-12,12-dimethyl-2,2-dioxo-8-[3-(trimethylsilylmethoxy)pyrazol-1-yl]-2λ6-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one (PubChem CID 156623746) has the molecular formula C27H37N7O4SSi and a molecular weight of 583.79 g/mol. Its IUPAC name is (14S)-12,12-dimethyl-2,2-dioxo-8-[3-(trimethylsilylmethoxy)pyrazol-1-yl]-2λ6-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one.
| Compound Name | (14S)-12,12-dimethyl-2,2-dioxo-8-[3-(trimethylsilylmethoxy)pyrazol-1-yl]-2λ6-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one |
|---|---|
| PubChem CID | 156623746 |
| Molecular Formula | C27H37N7O4SSi |
| Molecular Weight | 583.79 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | (14S)-12,12-dimethyl-2,2-dioxo-8-[3-(trimethylsilylmethoxy)pyrazol-1-yl]-2λ6-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one |
| SMILES | CC1(C)C[C@@H]2CCCNc3cccc(n3)S(=O)(=O)NC(=O)c3ccc(-n4ccc(OC[Si](C)(C)C)n4)nc3N1C2 |
| InChI | InChI=1S/C27H37N7O4SSi/c1-27(2)16-19-8-7-14-28-21-9-6-10-24(29-21)39(36,37)32-26(35)20-11-12-22(30-25(20)33(27)17-19)34-15-13-23(31-34)38-18-40(3,4)5/h6,9-13,15,19H,7-8,14,16-18H2,1-5H3,(H,28,29)(H,32,35)/t19-/m0/s1 |
| InChIKey | VXNBAFISXVKPSZ-IBGZPJMESA-N |
| XLogP | 3.85 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.79 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|