C18H22FNO4 — CID 156624249
(1R,6S)-7-[6-(4-fluorophenyl)hex-5-ynyl]-7-azabicyclo[4.1.0]heptane-2,3,4,5-tetrol (PubChem CID 156624249) has the molecular formula C18H22FNO4 and a molecular weight of 335.38 g/mol. Its IUPAC name is (1R,6S)-7-[6-(4-fluorophenyl)hex-5-ynyl]-7-azabicyclo[4.1.0]heptane-2,3,4,5-tetrol.
| Compound Name | (1R,6S)-7-[6-(4-fluorophenyl)hex-5-ynyl]-7-azabicyclo[4.1.0]heptane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 156624249 |
| Molecular Formula | C18H22FNO4 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | (1R,6S)-7-[6-(4-fluorophenyl)hex-5-ynyl]-7-azabicyclo[4.1.0]heptane-2,3,4,5-tetrol |
| SMILES | OC1C(O)C(O)[C@H]2[C@@H](C1O)N2CCCCC#Cc1ccc(F)cc1 |
| InChI | InChI=1S/C18H22FNO4/c19-12-8-6-11(7-9-12)5-3-1-2-4-10-20-13-14(20)16(22)18(24)17(23)15(13)21/h6-9,13-18,21-24H,1-2,4,10H2/t13-,14+,15?,16?,17?,18?,20? |
| InChIKey | FDFYTGNXHKTWNR-ZBIYFPSISA-N |
| XLogP | -0.14 |
| TPSA | 83.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|