C12H24O — CID 156624671
(Z)-4-methoxy-2,2,6,6-tetramethylhept-3-ene (PubChem CID 156624671) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is (Z)-4-methoxy-2,2,6,6-tetramethylhept-3-ene.
| Compound Name | (Z)-4-methoxy-2,2,6,6-tetramethylhept-3-ene |
|---|---|
| PubChem CID | 156624671 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | (Z)-4-methoxy-2,2,6,6-tetramethylhept-3-ene |
| SMILES | CO/C(=C\C(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C12H24O/c1-11(2,3)8-10(13-7)9-12(4,5)6/h8H,9H2,1-7H3/b10-8- |
| InChIKey | FFQQLTJMQPRIPI-NTMALXAHSA-N |
| XLogP | 4.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|