C13H21N2P — CID 156624677
(1S)-1-(2-phosphanylcyclopentyl)-N-(pyridin-2-ylmethyl)ethanamine (PubChem CID 156624677) has the molecular formula C13H21N2P and a molecular weight of 236.30 g/mol. Its IUPAC name is (1S)-1-(2-phosphanylcyclopentyl)-N-(pyridin-2-ylmethyl)ethanamine.
| Compound Name | (1S)-1-(2-phosphanylcyclopentyl)-N-(pyridin-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 156624677 |
| Molecular Formula | C13H21N2P |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (1S)-1-(2-phosphanylcyclopentyl)-N-(pyridin-2-ylmethyl)ethanamine |
| SMILES | C[C@H](NCc1ccccn1)C1CCCC1P |
| InChI | InChI=1S/C13H21N2P/c1-10(12-6-4-7-13(12)16)15-9-11-5-2-3-8-14-11/h2-3,5,8,10,12-13,15H,4,6-7,9,16H2,1H3/t10-,12?,13?/m0/s1 |
| InChIKey | HPTNCMQOZYNZBU-PKSQDBQZSA-N |
| XLogP | 2.60 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|