C21H33N3O2 — CID 156624790
(3S,8R,10S,13S,14S)-3-azido-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane] (PubChem CID 156624790) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is (3S,8R,10S,13S,14S)-3-azido-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane].
| Compound Name | (3S,8R,10S,13S,14S)-3-azido-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 156624790 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | (3S,8R,10S,13S,14S)-3-azido-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane] |
| SMILES | C[C@]12CC[C@H](N=[N+]=[N-])CC1CC[C@@H]1C2CC[C@@]2(C)[C@H]1CCC21OCCO1 |
| InChI | InChI=1S/C21H33N3O2/c1-19-8-5-15(23-24-22)13-14(19)3-4-16-17(19)6-9-20(2)18(16)7-10-21(20)25-11-12-26-21/h14-18H,3-13H2,1-2H3/t14?,15-,16+,17?,18-,19-,20-/m0/s1 |
| InChIKey | FVZXGRBQLKPKFE-GWSBQFQASA-N |
| XLogP | 5.45 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|