C28H50O4Si3 — CID 156626373
3-[methyl-bis(trimethylsilyloxy)silyl]oxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenol (PubChem CID 156626373) has the molecular formula C28H50O4Si3 and a molecular weight of 534.96 g/mol. Its IUPAC name is 3-[methyl-bis(trimethylsilyloxy)silyl]oxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenol.
| Compound Name | 3-[methyl-bis(trimethylsilyloxy)silyl]oxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenol |
|---|---|
| PubChem CID | 156626373 |
| Molecular Formula | C28H50O4Si3 |
| Molecular Weight | 534.96 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | 3-[methyl-bis(trimethylsilyloxy)silyl]oxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenol |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1O[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C28H50O4Si3/c1-12-13-14-15-23-19-26(29)28(25-18-22(4)16-17-24(25)21(2)3)27(20-23)30-35(11,31-33(5,6)7)32-34(8,9)10/h18-20,24-25,29H,2,12-17H2,1,3-11H3/t24-,25+/m0/s1 |
| InChIKey | HWFHCDQKXTYHLJ-LOSJGSFVSA-N |
| XLogP | 8.79 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.96 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|