C44H60Si — CID 156627158
bis[4-(4-tert-butylphenyl)-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-methyl-propylsilane (PubChem CID 156627158) has the molecular formula C44H60Si and a molecular weight of 617.05 g/mol. Its IUPAC name is bis[4-(4-tert-butylphenyl)-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-methyl-propylsilane.
| Compound Name | bis[4-(4-tert-butylphenyl)-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-methyl-propylsilane |
|---|---|
| PubChem CID | 156627158 |
| Molecular Formula | C44H60Si |
| Molecular Weight | 617.05 g/mol |
| Exact Mass | 616.45 |
| IUPAC Name | bis[4-(4-tert-butylphenyl)-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-methyl-propylsilane |
| SMILES | CCC[Si](C)(C1C(C)CC2C(c3ccc(C(C)(C)C)cc3)=CC=CC21)C1C(C)CC2C(c3ccc(C(C)(C)C)cc3)=CC=CC21 |
| InChI | InChI=1S/C44H60Si/c1-11-26-45(10,41-29(2)27-39-35(14-12-16-37(39)41)31-18-22-33(23-19-31)43(4,5)6)42-30(3)28-40-36(15-13-17-38(40)42)32-20-24-34(25-21-32)44(7,8)9/h12-25,29-30,37-42H,11,26-28H2,1-10H3 |
| InChIKey | NCTLBUIKGATWBM-UHFFFAOYSA-N |
| XLogP | 12.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.05 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|