C21H33N3O12 — CID 156627271
2-hydroxybutyl 2-[3,5-bis[2-(2-hydroxybutoxy)-2-oxoethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]acetate (PubChem CID 156627271) has the molecular formula C21H33N3O12 and a molecular weight of 519.50 g/mol. Its IUPAC name is 2-hydroxybutyl 2-[3,5-bis[2-(2-hydroxybutoxy)-2-oxoethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]acetate.
| Compound Name | 2-hydroxybutyl 2-[3,5-bis[2-(2-hydroxybutoxy)-2-oxoethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]acetate |
|---|---|
| PubChem CID | 156627271 |
| Molecular Formula | C21H33N3O12 |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | 2-hydroxybutyl 2-[3,5-bis[2-(2-hydroxybutoxy)-2-oxoethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]acetate |
| SMILES | CCC(O)COC(=O)Cn1c(=O)n(CC(=O)OCC(O)CC)c(=O)n(CC(=O)OCC(O)CC)c1=O |
| InChI | InChI=1S/C21H33N3O12/c1-4-13(25)10-34-16(28)7-22-19(31)23(8-17(29)35-11-14(26)5-2)21(33)24(20(22)32)9-18(30)36-12-15(27)6-3/h13-15,25-27H,4-12H2,1-3H3 |
| InChIKey | RZAFZYZQGDQTIQ-UHFFFAOYSA-N |
| XLogP | -2.89 |
| TPSA | 205.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|