About CID 156627313
CID 156627313 (PubChem CID 156627313) has the molecular formula C42H33N4O2Pt-3
and a molecular weight of 820.83 g/mol.
Molecular Properties
| Compound Name | CID 156627313 |
| PubChem CID | 156627313 |
| Molecular Formula | C42H33N4O2Pt-3 |
| Molecular Weight | 820.83 g/mol |
| Exact Mass | 820.23 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1cnn(-c2[c-]c3c(cc2)oc2ccc4oc5ccc(N6C=CN(c7ccccc7)[CH-]6)[c-]c5c4c23)c1.[Pt] |
| InChI | InChI=1S/C42H33N4O2.Pt/c1-26(2)32-11-8-12-33(27(3)4)40(32)28-23-43-46(24-28)31-14-16-37-35(22-31)42-39(48-37)18-17-38-41(42)34-21-30(13-15-36(34)47-38)45-20-19-44(25-45)29-9-6-5-7-10-29;/h5-20,23-27H,1-4H3;/q-3; |
| InChIKey | CDMWKHBXSHKJPO-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 50.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 820.83 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 156627313 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156627313?
The IUPAC name of CID 156627313 (CID 156627313) is not available.
What is the SMILES notation for CID 156627313?
The canonical SMILES for CID 156627313 is CC(C)c1cccc(C(C)C)c1-c1cnn(-c2[c-]c3c(cc2)oc2ccc4oc5ccc(N6C=CN(c7ccccc7)[CH-]6)[c-]c5c4c23)c1.[Pt].
What is the InChIKey of CID 156627313?
The InChIKey is CDMWKHBXSHKJPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H33N4O2.Pt/c1-26(2)32-11-8-12-33(27(3)4)40(32)28-23-43-46(24-28)31-14-16-37-35(22-31)42-39(48-37)18-17-38-41(42)34-21-30(13-15-36(34)47-38)45-20-19-44(25-45)29-9-6-5-7-10-29;/h5-20,23-27H,1-4H3;/q-3;.
What are the key properties of CID 156627313?
CID 156627313 has a molecular weight of 820.83 g/mol, XLogP of 11.10, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156627313 is sourced from PubChem (CID 156627313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).