About 2-[(1R,4E)-cyclooct-4-en-1-yl]oxy-N-propylacetamide
2-[(1R,4E)-cyclooct-4-en-1-yl]oxy-N-propylacetamide (PubChem CID 156628315) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is 2-[(1R,4E)-cyclooct-4-en-1-yl]oxy-N-propylacetamide.
Molecular Properties
| Compound Name | 2-[(1R,4E)-cyclooct-4-en-1-yl]oxy-N-propylacetamide |
| PubChem CID | 156628315 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 2-[(1R,4E)-cyclooct-4-en-1-yl]oxy-N-propylacetamide |
| SMILES | CCCNC(=O)CO[C@H]1CC/C=C\CCC1 |
| InChI | InChI=1S/C13H23NO2/c1-2-10-14-13(15)11-16-12-8-6-4-3-5-7-9-12/h3-4,12H,2,5-11H2,1H3,(H,14,15)/b4-3-/t12-/m0/s1 |
| InChIKey | BQIGAFUHRIOIOA-MVZIDQBPSA-N |
| XLogP | 2.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R,4E)-cyclooct-4-en-1-yl]oxy-N-propylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,4E)-cyclooct-4-en-1-yl]oxy-N-propylacetamide?
The IUPAC name of 2-[(1R,4E)-cyclooct-4-en-1-yl]oxy-N-propylacetamide (CID 156628315) is 2-[(1R,4E)-cyclooct-4-en-1-yl]oxy-N-propylacetamide.
What is the SMILES notation for 2-[(1R,4E)-cyclooct-4-en-1-yl]oxy-N-propylacetamide?
The canonical SMILES for 2-[(1R,4E)-cyclooct-4-en-1-yl]oxy-N-propylacetamide is CCCNC(=O)CO[C@H]1CC/C=C\CCC1.
What is the InChIKey of 2-[(1R,4E)-cyclooct-4-en-1-yl]oxy-N-propylacetamide?
The InChIKey is BQIGAFUHRIOIOA-MVZIDQBPSA-N. The full InChI is InChI=1S/C13H23NO2/c1-2-10-14-13(15)11-16-12-8-6-4-3-5-7-9-12/h3-4,12H,2,5-11H2,1H3,(H,14,15)/b4-3-/t12-/m0/s1.
What are the key properties of 2-[(1R,4E)-cyclooct-4-en-1-yl]oxy-N-propylacetamide?
2-[(1R,4E)-cyclooct-4-en-1-yl]oxy-N-propylacetamide has a molecular weight of 225.33 g/mol, XLogP of 2.42, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,4E)-cyclooct-4-en-1-yl]oxy-N-propylacetamide is sourced from PubChem (CID 156628315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).