C10H11N3Zn — CID 156628337
zinc;carbanide;2-(5-methylpyrazol-2-id-3-yl)pyridine (PubChem CID 156628337) has the molecular formula C10H11N3Zn and a molecular weight of 238.61 g/mol. Its IUPAC name is zinc;carbanide;2-(5-methylpyrazol-2-id-3-yl)pyridine.
| Compound Name | zinc;carbanide;2-(5-methylpyrazol-2-id-3-yl)pyridine |
|---|---|
| PubChem CID | 156628337 |
| Molecular Formula | C10H11N3Zn |
| Molecular Weight | 238.61 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | zinc;carbanide;2-(5-methylpyrazol-2-id-3-yl)pyridine |
| SMILES | Cc1cc(-c2ccccn2)[n-]n1.[CH3-].[Zn+2] |
| InChI | InChI=1S/C9H8N3.CH3.Zn/c1-7-6-9(12-11-7)8-4-2-3-5-10-8;;/h2-6H,1H3;1H3;/q2*-1;+2 |
| InChIKey | SHRVHIFNSCCHIB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 39.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.61 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|