About 1-[1,1-bis(4-prop-2-ynoxyphenyl)ethyl]-4-cyclohexylbenzene
1-[1,1-bis(4-prop-2-ynoxyphenyl)ethyl]-4-cyclohexylbenzene (PubChem CID 156628512) has the molecular formula C32H32O2
and a molecular weight of 448.61 g/mol. Its IUPAC name is 1-[1,1-bis(4-prop-2-ynoxyphenyl)ethyl]-4-cyclohexylbenzene.
Molecular Properties
| Compound Name | 1-[1,1-bis(4-prop-2-ynoxyphenyl)ethyl]-4-cyclohexylbenzene |
| PubChem CID | 156628512 |
| Molecular Formula | C32H32O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 1-[1,1-bis(4-prop-2-ynoxyphenyl)ethyl]-4-cyclohexylbenzene |
| SMILES | C#CCOc1ccc(C(C)(c2ccc(OCC#C)cc2)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C32H32O2/c1-4-23-33-30-19-15-28(16-20-30)32(3,29-17-21-31(22-18-29)34-24-5-2)27-13-11-26(12-14-27)25-9-7-6-8-10-25/h1-2,11-22,25H,6-10,23-24H2,3H3 |
| InChIKey | LKHWAKMJLZEXSW-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[1,1-bis(4-prop-2-ynoxyphenyl)ethyl]-4-cyclohexylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1,1-bis(4-prop-2-ynoxyphenyl)ethyl]-4-cyclohexylbenzene?
The IUPAC name of 1-[1,1-bis(4-prop-2-ynoxyphenyl)ethyl]-4-cyclohexylbenzene (CID 156628512) is 1-[1,1-bis(4-prop-2-ynoxyphenyl)ethyl]-4-cyclohexylbenzene.
What is the SMILES notation for 1-[1,1-bis(4-prop-2-ynoxyphenyl)ethyl]-4-cyclohexylbenzene?
The canonical SMILES for 1-[1,1-bis(4-prop-2-ynoxyphenyl)ethyl]-4-cyclohexylbenzene is C#CCOc1ccc(C(C)(c2ccc(OCC#C)cc2)c2ccc(C3CCCCC3)cc2)cc1.
What is the InChIKey of 1-[1,1-bis(4-prop-2-ynoxyphenyl)ethyl]-4-cyclohexylbenzene?
The InChIKey is LKHWAKMJLZEXSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H32O2/c1-4-23-33-30-19-15-28(16-20-30)32(3,29-17-21-31(22-18-29)34-24-5-2)27-13-11-26(12-14-27)25-9-7-6-8-10-25/h1-2,11-22,25H,6-10,23-24H2,3H3.
What are the key properties of 1-[1,1-bis(4-prop-2-ynoxyphenyl)ethyl]-4-cyclohexylbenzene?
1-[1,1-bis(4-prop-2-ynoxyphenyl)ethyl]-4-cyclohexylbenzene has a molecular weight of 448.61 g/mol, XLogP of 7.11, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1,1-bis(4-prop-2-ynoxyphenyl)ethyl]-4-cyclohexylbenzene is sourced from PubChem (CID 156628512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).