C8H12N2S — CID 156628600
1,2,5,6-tetramethylpyrimidine-4-thione (PubChem CID 156628600) has the molecular formula C8H12N2S and a molecular weight of 168.26 g/mol. Its IUPAC name is 1,2,5,6-tetramethylpyrimidine-4-thione.
| Compound Name | 1,2,5,6-tetramethylpyrimidine-4-thione |
|---|---|
| PubChem CID | 156628600 |
| Molecular Formula | C8H12N2S |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 1,2,5,6-tetramethylpyrimidine-4-thione |
| SMILES | Cc1c(C)n(C)c(C)nc1=S |
| InChI | InChI=1S/C8H12N2S/c1-5-6(2)10(4)7(3)9-8(5)11/h1-4H3 |
| InChIKey | LEOUVOCPVXFIHW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|