C19H21NO7 — CID 15662869
6-hydroxy-1,2,3,4,5-pentamethoxy-10-methylacridin-9-one (PubChem CID 15662869) has the molecular formula C19H21NO7 and a molecular weight of 375.38 g/mol. Its IUPAC name is 6-hydroxy-1,2,3,4,5-pentamethoxy-10-methylacridin-9-one.
| Compound Name | 6-hydroxy-1,2,3,4,5-pentamethoxy-10-methylacridin-9-one |
|---|---|
| PubChem CID | 15662869 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 6-hydroxy-1,2,3,4,5-pentamethoxy-10-methylacridin-9-one |
| SMILES | COc1c(OC)c(OC)c2c(c1OC)c(=O)c1ccc(O)c(OC)c1n2C |
| InChI | InChI=1S/C19H21NO7/c1-20-12-9(7-8-10(21)15(12)23-2)14(22)11-13(20)17(25-4)19(27-6)18(26-5)16(11)24-3/h7-8,21H,1-6H3 |
| InChIKey | ZMYQQLDJBDKYBW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|