C33H45N3O8 — CID 156629313
2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 2-[1-[6-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]hexanoyl]-2,3-dihydroindol-3-yl]acetate (PubChem CID 156629313) has the molecular formula C33H45N3O8 and a molecular weight of 611.74 g/mol. Its IUPAC name is 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 2-[1-[6-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]hexanoyl]-2,3-dihydroindol-3-yl]acetate.
| Compound Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 2-[1-[6-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]hexanoyl]-2,3-dihydroindol-3-yl]acetate |
|---|---|
| PubChem CID | 156629313 |
| Molecular Formula | C33H45N3O8 |
| Molecular Weight | 611.74 g/mol |
| Exact Mass | 611.32 |
| IUPAC Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 2-[1-[6-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]hexanoyl]-2,3-dihydroindol-3-yl]acetate |
| SMILES | COCCOCCOCCOCCOC(=O)CC1CN(C(=O)CCCCCNC(=O)/C=C/c2cccnc2)c2ccccc21 |
| InChI | InChI=1S/C33H45N3O8/c1-40-16-17-41-18-19-42-20-21-43-22-23-44-33(39)24-28-26-36(30-10-5-4-9-29(28)30)32(38)11-3-2-6-15-35-31(37)13-12-27-8-7-14-34-25-27/h4-5,7-10,12-14,25,28H,2-3,6,11,15-24,26H2,1H3,(H,35,37)/b13-12+ |
| InChIKey | RKFUHBFIDYRYNC-OUKQBFOZSA-N |
| XLogP | 3.53 |
| TPSA | 125.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.74 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|