C27H28F3IrN4O2S- — CID 156629483
4-(3H-1-benzothiophen-3-id-2-yl)-2,6,7-trifluoropteridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 156629483) has the molecular formula C27H28F3IrN4O2S- and a molecular weight of 721.82 g/mol. Its IUPAC name is 4-(3H-1-benzothiophen-3-id-2-yl)-2,6,7-trifluoropteridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 4-(3H-1-benzothiophen-3-id-2-yl)-2,6,7-trifluoropteridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 156629483 |
| Molecular Formula | C27H28F3IrN4O2S- |
| Molecular Weight | 721.82 g/mol |
| Exact Mass | 722.15 |
| IUPAC Name | 4-(3H-1-benzothiophen-3-id-2-yl)-2,6,7-trifluoropteridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Fc1nc(-c2[c-]c3ccccc3s2)c2nc(F)c(F)nc2n1.[Ir] |
| InChI | InChI=1S/C14H4F3N4S.C13H24O2.Ir/c15-11-12(16)20-13-10(18-11)9(19-14(17)21-13)8-5-6-3-1-2-4-7(6)22-8;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h1-4H;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | HVPTUVGBMBHAGW-DZTQYQPZSA-N |
| XLogP | 7.39 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.82 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|