C34H42IrN3O2- — CID 156629499
3-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-1,2,4-benzotriazine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 156629499) has the molecular formula C34H42IrN3O2- and a molecular weight of 716.95 g/mol. Its IUPAC name is 3-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-1,2,4-benzotriazine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 3-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-1,2,4-benzotriazine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 156629499 |
| Molecular Formula | C34H42IrN3O2- |
| Molecular Weight | 716.95 g/mol |
| Exact Mass | 717.29 |
| IUPAC Name | 3-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-1,2,4-benzotriazine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CC(C)(C)c1cc(-c2nnc3ccccc3n2)[c-]c2ccccc12.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir] |
| InChI | InChI=1S/C21H18N3.C13H24O2.Ir/c1-21(2,3)17-13-15(12-14-8-4-5-9-16(14)17)20-22-18-10-6-7-11-19(18)23-24-20;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h4-11,13H,1-3H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | SVFYBESJJJPHIN-DZTQYQPZSA-N |
| XLogP | 8.81 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.95 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|