C38H37BN2O2 — CID 156629901
4-butyl-2-[18-(4-butyl-2-pyridinyl)-11-ethyl-8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-4-yl]pyridine (PubChem CID 156629901) has the molecular formula C38H37BN2O2 and a molecular weight of 564.54 g/mol. Its IUPAC name is 4-butyl-2-[18-(4-butyl-2-pyridinyl)-11-ethyl-8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-4-yl]pyridine.
| Compound Name | 4-butyl-2-[18-(4-butyl-2-pyridinyl)-11-ethyl-8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-4-yl]pyridine |
|---|---|
| PubChem CID | 156629901 |
| Molecular Formula | C38H37BN2O2 |
| Molecular Weight | 564.54 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | 4-butyl-2-[18-(4-butyl-2-pyridinyl)-11-ethyl-8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-4-yl]pyridine |
| SMILES | CCCCc1ccnc(-c2ccc3c(c2)B2c4cc(-c5cc(CCCC)ccn5)ccc4Oc4cc(CC)cc(c42)O3)c1 |
| InChI | InChI=1S/C38H37BN2O2/c1-4-7-9-26-15-17-40-32(19-26)28-11-13-34-30(23-28)39-31-24-29(33-20-27(10-8-5-2)16-18-41-33)12-14-35(31)43-37-22-25(6-3)21-36(42-34)38(37)39/h11-24H,4-10H2,1-3H3 |
| InChIKey | CCTVWLNKNMJLNA-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.54 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|