C21H31FN2O3 — CID 156630580
tert-butyl N-[(3R)-1-[4-(4-fluorophenyl)-2-hydroxycyclopentyl]piperidin-3-yl]carbamate (PubChem CID 156630580) has the molecular formula C21H31FN2O3 and a molecular weight of 378.49 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[4-(4-fluorophenyl)-2-hydroxycyclopentyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[4-(4-fluorophenyl)-2-hydroxycyclopentyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 156630580 |
| Molecular Formula | C21H31FN2O3 |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | tert-butyl N-[(3R)-1-[4-(4-fluorophenyl)-2-hydroxycyclopentyl]piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCN(C2CC(c3ccc(F)cc3)CC2O)C1 |
| InChI | InChI=1S/C21H31FN2O3/c1-21(2,3)27-20(26)23-17-5-4-10-24(13-17)18-11-15(12-19(18)25)14-6-8-16(22)9-7-14/h6-9,15,17-19,25H,4-5,10-13H2,1-3H3,(H,23,26)/t15?,17-,18?,19?/m1/s1 |
| InChIKey | CCMIIWVSRJUQIA-AGRCYTFUSA-N |
| XLogP | 3.42 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |