About 3,3-difluoro-1,2-dihydroindol-2-ol
3,3-difluoro-1,2-dihydroindol-2-ol (PubChem CID 156630733) has the molecular formula C8H7F2NO
and a molecular weight of 171.15 g/mol. Its IUPAC name is 3,3-difluoro-1,2-dihydroindol-2-ol.
Molecular Properties
| Compound Name | 3,3-difluoro-1,2-dihydroindol-2-ol |
| PubChem CID | 156630733 |
| Molecular Formula | C8H7F2NO |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 3,3-difluoro-1,2-dihydroindol-2-ol |
| SMILES | OC1Nc2ccccc2C1(F)F |
| InChI | InChI=1S/C8H7F2NO/c9-8(10)5-3-1-2-4-6(5)11-7(8)12/h1-4,7,11-12H |
| InChIKey | CTMODJQZGBOWGL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-difluoro-1,2-dihydroindol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-1,2-dihydroindol-2-ol?
The IUPAC name of 3,3-difluoro-1,2-dihydroindol-2-ol (CID 156630733) is 3,3-difluoro-1,2-dihydroindol-2-ol.
What is the SMILES notation for 3,3-difluoro-1,2-dihydroindol-2-ol?
The canonical SMILES for 3,3-difluoro-1,2-dihydroindol-2-ol is OC1Nc2ccccc2C1(F)F.
What is the InChIKey of 3,3-difluoro-1,2-dihydroindol-2-ol?
The InChIKey is CTMODJQZGBOWGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F2NO/c9-8(10)5-3-1-2-4-6(5)11-7(8)12/h1-4,7,11-12H.
What are the key properties of 3,3-difluoro-1,2-dihydroindol-2-ol?
3,3-difluoro-1,2-dihydroindol-2-ol has a molecular weight of 171.15 g/mol, XLogP of 1.52, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-1,2-dihydroindol-2-ol is sourced from PubChem (CID 156630733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).