About 1-fluoro-11H-indeno[1,2-h]isoquinoline
1-fluoro-11H-indeno[1,2-h]isoquinoline (PubChem CID 156630823) has the molecular formula C16H10FN
and a molecular weight of 235.26 g/mol. Its IUPAC name is 1-fluoro-11H-indeno[1,2-h]isoquinoline.
Molecular Properties
| Compound Name | 1-fluoro-11H-indeno[1,2-h]isoquinoline |
| PubChem CID | 156630823 |
| Molecular Formula | C16H10FN |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 1-fluoro-11H-indeno[1,2-h]isoquinoline |
| SMILES | Fc1nccc2ccc3c(c12)Cc1ccccc1-3 |
| InChI | InChI=1S/C16H10FN/c17-16-15-10(7-8-18-16)5-6-13-12-4-2-1-3-11(12)9-14(13)15/h1-8H,9H2 |
| InChIKey | HXEIGCIIZQHPEY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-11H-indeno[1,2-h]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-11H-indeno[1,2-h]isoquinoline?
The IUPAC name of 1-fluoro-11H-indeno[1,2-h]isoquinoline (CID 156630823) is 1-fluoro-11H-indeno[1,2-h]isoquinoline.
What is the SMILES notation for 1-fluoro-11H-indeno[1,2-h]isoquinoline?
The canonical SMILES for 1-fluoro-11H-indeno[1,2-h]isoquinoline is Fc1nccc2ccc3c(c12)Cc1ccccc1-3.
What is the InChIKey of 1-fluoro-11H-indeno[1,2-h]isoquinoline?
The InChIKey is HXEIGCIIZQHPEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10FN/c17-16-15-10(7-8-18-16)5-6-13-12-4-2-1-3-11(12)9-14(13)15/h1-8H,9H2.
What are the key properties of 1-fluoro-11H-indeno[1,2-h]isoquinoline?
1-fluoro-11H-indeno[1,2-h]isoquinoline has a molecular weight of 235.26 g/mol, XLogP of 3.95, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-11H-indeno[1,2-h]isoquinoline is sourced from PubChem (CID 156630823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).