About 4-[[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]diazenyl]phenol
4-[[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]diazenyl]phenol (PubChem CID 156631018) has the molecular formula C18H15F3N4O
and a molecular weight of 360.34 g/mol. Its IUPAC name is 4-[[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]diazenyl]phenol.
Molecular Properties
| Compound Name | 4-[[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]diazenyl]phenol |
| PubChem CID | 156631018 |
| Molecular Formula | C18H15F3N4O |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 4-[[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]diazenyl]phenol |
| SMILES | Cc1nn(-c2ccc(C(F)(F)F)cc2)c(C)c1/N=N/c1ccc(O)cc1 |
| InChI | InChI=1S/C18H15F3N4O/c1-11-17(23-22-14-5-9-16(26)10-6-14)12(2)25(24-11)15-7-3-13(4-8-15)18(19,20)21/h3-10,26H,1-2H3/b23-22+ |
| InChIKey | ZIVNZBGTJWNKQU-GHVJWSGMSA-N |
| XLogP | 5.63 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]diazenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]diazenyl]phenol?
The IUPAC name of 4-[[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]diazenyl]phenol (CID 156631018) is 4-[[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]diazenyl]phenol.
What is the SMILES notation for 4-[[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]diazenyl]phenol?
The canonical SMILES for 4-[[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]diazenyl]phenol is Cc1nn(-c2ccc(C(F)(F)F)cc2)c(C)c1/N=N/c1ccc(O)cc1.
What is the InChIKey of 4-[[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]diazenyl]phenol?
The InChIKey is ZIVNZBGTJWNKQU-GHVJWSGMSA-N. The full InChI is InChI=1S/C18H15F3N4O/c1-11-17(23-22-14-5-9-16(26)10-6-14)12(2)25(24-11)15-7-3-13(4-8-15)18(19,20)21/h3-10,26H,1-2H3/b23-22+.
What are the key properties of 4-[[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]diazenyl]phenol?
4-[[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]diazenyl]phenol has a molecular weight of 360.34 g/mol, XLogP of 5.63, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]diazenyl]phenol is sourced from PubChem (CID 156631018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).