C25H19F3FeN2S — CID 156631138
4-benzyl-1-cyclopenta-2,4-dien-1-yl-5-thiophen-2-yl-3-(trifluoromethyl)pyrazole;cyclopenta-1,3-diene;iron(2+) (PubChem CID 156631138) has the molecular formula C25H19F3FeN2S and a molecular weight of 492.35 g/mol. Its IUPAC name is 4-benzyl-1-cyclopenta-2,4-dien-1-yl-5-thiophen-2-yl-3-(trifluoromethyl)pyrazole;cyclopenta-1,3-diene;iron(2+).
| Compound Name | 4-benzyl-1-cyclopenta-2,4-dien-1-yl-5-thiophen-2-yl-3-(trifluoromethyl)pyrazole;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 156631138 |
| Molecular Formula | C25H19F3FeN2S |
| Molecular Weight | 492.35 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | 4-benzyl-1-cyclopenta-2,4-dien-1-yl-5-thiophen-2-yl-3-(trifluoromethyl)pyrazole;cyclopenta-1,3-diene;iron(2+) |
| SMILES | FC(F)(F)c1nn(-[c-]2cccc2)c(-c2cccs2)c1Cc1ccccc1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C20H14F3N2S.C5H5.Fe/c21-20(22,23)19-16(13-14-7-2-1-3-8-14)18(17-11-6-12-26-17)25(24-19)15-9-4-5-10-15;1-2-4-5-3-1;/h1-12H,13H2;1-5H;/q2*-1;+2 |
| InChIKey | GNKBYOZWWZBTMC-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.35 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|