About ethyl 5-[(5-bromo-1,2-dihydroindol-3-ylidene)methyl]-2-methyl-4-phenyl-1H-pyrrole-3-carboxylate
ethyl 5-[(5-bromo-1,2-dihydroindol-3-ylidene)methyl]-2-methyl-4-phenyl-1H-pyrrole-3-carboxylate (PubChem CID 156631784) has the molecular formula C23H21BrN2O2
and a molecular weight of 437.34 g/mol. Its IUPAC name is ethyl 5-[(5-bromo-1,2-dihydroindol-3-ylidene)methyl]-2-methyl-4-phenyl-1H-pyrrole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[(5-bromo-1,2-dihydroindol-3-ylidene)methyl]-2-methyl-4-phenyl-1H-pyrrole-3-carboxylate |
| PubChem CID | 156631784 |
| Molecular Formula | C23H21BrN2O2 |
| Molecular Weight | 437.34 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | ethyl 5-[(5-bromo-1,2-dihydroindol-3-ylidene)methyl]-2-methyl-4-phenyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C=C2CNc3ccc(Br)cc32)c1-c1ccccc1 |
| InChI | InChI=1S/C23H21BrN2O2/c1-3-28-23(27)21-14(2)26-20(22(21)15-7-5-4-6-8-15)11-16-13-25-19-10-9-17(24)12-18(16)19/h4-12,25-26H,3,13H2,1-2H3 |
| InChIKey | IGNFEXXATMIWCN-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.34 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 5-[(5-bromo-1,2-dihydroindol-3-ylidene)methyl]-2-methyl-4-phenyl-1H-pyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[(5-bromo-1,2-dihydroindol-3-ylidene)methyl]-2-methyl-4-phenyl-1H-pyrrole-3-carboxylate?
The IUPAC name of ethyl 5-[(5-bromo-1,2-dihydroindol-3-ylidene)methyl]-2-methyl-4-phenyl-1H-pyrrole-3-carboxylate (CID 156631784) is ethyl 5-[(5-bromo-1,2-dihydroindol-3-ylidene)methyl]-2-methyl-4-phenyl-1H-pyrrole-3-carboxylate.
What is the SMILES notation for ethyl 5-[(5-bromo-1,2-dihydroindol-3-ylidene)methyl]-2-methyl-4-phenyl-1H-pyrrole-3-carboxylate?
The canonical SMILES for ethyl 5-[(5-bromo-1,2-dihydroindol-3-ylidene)methyl]-2-methyl-4-phenyl-1H-pyrrole-3-carboxylate is CCOC(=O)c1c(C)[nH]c(C=C2CNc3ccc(Br)cc32)c1-c1ccccc1.
What is the InChIKey of ethyl 5-[(5-bromo-1,2-dihydroindol-3-ylidene)methyl]-2-methyl-4-phenyl-1H-pyrrole-3-carboxylate?
The InChIKey is IGNFEXXATMIWCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21BrN2O2/c1-3-28-23(27)21-14(2)26-20(22(21)15-7-5-4-6-8-15)11-16-13-25-19-10-9-17(24)12-18(16)19/h4-12,25-26H,3,13H2,1-2H3.
What are the key properties of ethyl 5-[(5-bromo-1,2-dihydroindol-3-ylidene)methyl]-2-methyl-4-phenyl-1H-pyrrole-3-carboxylate?
ethyl 5-[(5-bromo-1,2-dihydroindol-3-ylidene)methyl]-2-methyl-4-phenyl-1H-pyrrole-3-carboxylate has a molecular weight of 437.34 g/mol, XLogP of 5.90, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[(5-bromo-1,2-dihydroindol-3-ylidene)methyl]-2-methyl-4-phenyl-1H-pyrrole-3-carboxylate is sourced from PubChem (CID 156631784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).