About [3-[(4E)-4-(aminomethylidene)-2-adamantyl]phenyl] nitrate;hydrochloride
[3-[(4E)-4-(aminomethylidene)-2-adamantyl]phenyl] nitrate;hydrochloride (PubChem CID 156632320) has the molecular formula C17H21ClN2O3
and a molecular weight of 336.82 g/mol. Its IUPAC name is [3-[(4E)-4-(aminomethylidene)-2-adamantyl]phenyl] nitrate;hydrochloride.
Molecular Properties
| Compound Name | [3-[(4E)-4-(aminomethylidene)-2-adamantyl]phenyl] nitrate;hydrochloride |
| PubChem CID | 156632320 |
| Molecular Formula | C17H21ClN2O3 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | [3-[(4E)-4-(aminomethylidene)-2-adamantyl]phenyl] nitrate;hydrochloride |
| SMILES | Cl.N/C=C1\C2CC3CC(C2)C(c2cccc(O[N+](=O)[O-])c2)C1C3 |
| InChI | InChI=1S/C17H20N2O3.ClH/c18-9-16-12-4-10-5-13(7-12)17(15(16)6-10)11-2-1-3-14(8-11)22-19(20)21;/h1-3,8-10,12-13,15,17H,4-7,18H2;1H/b16-9+; |
| InChIKey | HJLMYIACKSBWRJ-QOVZSLTQSA-N |
| XLogP | 3.67 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-[(4E)-4-(aminomethylidene)-2-adamantyl]phenyl] nitrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(4E)-4-(aminomethylidene)-2-adamantyl]phenyl] nitrate;hydrochloride?
The IUPAC name of [3-[(4E)-4-(aminomethylidene)-2-adamantyl]phenyl] nitrate;hydrochloride (CID 156632320) is [3-[(4E)-4-(aminomethylidene)-2-adamantyl]phenyl] nitrate;hydrochloride.
What is the SMILES notation for [3-[(4E)-4-(aminomethylidene)-2-adamantyl]phenyl] nitrate;hydrochloride?
The canonical SMILES for [3-[(4E)-4-(aminomethylidene)-2-adamantyl]phenyl] nitrate;hydrochloride is Cl.N/C=C1\C2CC3CC(C2)C(c2cccc(O[N+](=O)[O-])c2)C1C3.
What is the InChIKey of [3-[(4E)-4-(aminomethylidene)-2-adamantyl]phenyl] nitrate;hydrochloride?
The InChIKey is HJLMYIACKSBWRJ-QOVZSLTQSA-N. The full InChI is InChI=1S/C17H20N2O3.ClH/c18-9-16-12-4-10-5-13(7-12)17(15(16)6-10)11-2-1-3-14(8-11)22-19(20)21;/h1-3,8-10,12-13,15,17H,4-7,18H2;1H/b16-9+;.
What are the key properties of [3-[(4E)-4-(aminomethylidene)-2-adamantyl]phenyl] nitrate;hydrochloride?
[3-[(4E)-4-(aminomethylidene)-2-adamantyl]phenyl] nitrate;hydrochloride has a molecular weight of 336.82 g/mol, XLogP of 3.67, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(4E)-4-(aminomethylidene)-2-adamantyl]phenyl] nitrate;hydrochloride is sourced from PubChem (CID 156632320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).