About 2-[(4S)-4-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-oxoacetic acid;hydrochloride
2-[(4S)-4-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-oxoacetic acid;hydrochloride (PubChem CID 156632480) has the molecular formula C12H12ClF2NO3
and a molecular weight of 291.68 g/mol. Its IUPAC name is 2-[(4S)-4-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-oxoacetic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-[(4S)-4-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-oxoacetic acid;hydrochloride |
| PubChem CID | 156632480 |
| Molecular Formula | C12H12ClF2NO3 |
| Molecular Weight | 291.68 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 2-[(4S)-4-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-oxoacetic acid;hydrochloride |
| SMILES | Cl.O=C(O)C(=O)C1C[C@@H](c2cc(F)cc(F)c2)CN1 |
| InChI | InChI=1S/C12H11F2NO3.ClH/c13-8-1-6(2-9(14)4-8)7-3-10(15-5-7)11(16)12(17)18;/h1-2,4,7,10,15H,3,5H2,(H,17,18);1H/t7-,10?;/m1./s1 |
| InChIKey | KOWDLEIHFSQFBS-OBENABSUSA-N |
| XLogP | 1.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.68 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4S)-4-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-oxoacetic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4S)-4-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-oxoacetic acid;hydrochloride?
The IUPAC name of 2-[(4S)-4-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-oxoacetic acid;hydrochloride (CID 156632480) is 2-[(4S)-4-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-oxoacetic acid;hydrochloride.
What is the SMILES notation for 2-[(4S)-4-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-oxoacetic acid;hydrochloride?
The canonical SMILES for 2-[(4S)-4-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-oxoacetic acid;hydrochloride is Cl.O=C(O)C(=O)C1C[C@@H](c2cc(F)cc(F)c2)CN1.
What is the InChIKey of 2-[(4S)-4-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-oxoacetic acid;hydrochloride?
The InChIKey is KOWDLEIHFSQFBS-OBENABSUSA-N. The full InChI is InChI=1S/C12H11F2NO3.ClH/c13-8-1-6(2-9(14)4-8)7-3-10(15-5-7)11(16)12(17)18;/h1-2,4,7,10,15H,3,5H2,(H,17,18);1H/t7-,10?;/m1./s1.
What are the key properties of 2-[(4S)-4-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-oxoacetic acid;hydrochloride?
2-[(4S)-4-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-oxoacetic acid;hydrochloride has a molecular weight of 291.68 g/mol, XLogP of 1.49, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4S)-4-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-oxoacetic acid;hydrochloride is sourced from PubChem (CID 156632480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).