About 6-bromo-4-fluorospiro[1,2-dihydroindole-3,4'-oxane]
6-bromo-4-fluorospiro[1,2-dihydroindole-3,4'-oxane] (PubChem CID 156632845) has the molecular formula C12H13BrFNO
and a molecular weight of 286.14 g/mol. Its IUPAC name is 6-bromo-4-fluorospiro[1,2-dihydroindole-3,4'-oxane].
Molecular Properties
| Compound Name | 6-bromo-4-fluorospiro[1,2-dihydroindole-3,4'-oxane] |
| PubChem CID | 156632845 |
| Molecular Formula | C12H13BrFNO |
| Molecular Weight | 286.14 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 6-bromo-4-fluorospiro[1,2-dihydroindole-3,4'-oxane] |
| SMILES | Fc1cc(Br)cc2c1C1(CCOCC1)CN2 |
| InChI | InChI=1S/C12H13BrFNO/c13-8-5-9(14)11-10(6-8)15-7-12(11)1-3-16-4-2-12/h5-6,15H,1-4,7H2 |
| InChIKey | BEFCFDZZQXENRN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.14 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-4-fluorospiro[1,2-dihydroindole-3,4'-oxane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4-fluorospiro[1,2-dihydroindole-3,4'-oxane]?
The IUPAC name of 6-bromo-4-fluorospiro[1,2-dihydroindole-3,4'-oxane] (CID 156632845) is 6-bromo-4-fluorospiro[1,2-dihydroindole-3,4'-oxane].
What is the SMILES notation for 6-bromo-4-fluorospiro[1,2-dihydroindole-3,4'-oxane]?
The canonical SMILES for 6-bromo-4-fluorospiro[1,2-dihydroindole-3,4'-oxane] is Fc1cc(Br)cc2c1C1(CCOCC1)CN2.
What is the InChIKey of 6-bromo-4-fluorospiro[1,2-dihydroindole-3,4'-oxane]?
The InChIKey is BEFCFDZZQXENRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrFNO/c13-8-5-9(14)11-10(6-8)15-7-12(11)1-3-16-4-2-12/h5-6,15H,1-4,7H2.
What are the key properties of 6-bromo-4-fluorospiro[1,2-dihydroindole-3,4'-oxane]?
6-bromo-4-fluorospiro[1,2-dihydroindole-3,4'-oxane] has a molecular weight of 286.14 g/mol, XLogP of 3.06, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4-fluorospiro[1,2-dihydroindole-3,4'-oxane] is sourced from PubChem (CID 156632845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).