C22H25FN4O2 — CID 156632963
3-(cyclopentylamino)-N-[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-4-methyl-1H-pyrrol-3-yl]propanamide (PubChem CID 156632963) has the molecular formula C22H25FN4O2 and a molecular weight of 396.47 g/mol. Its IUPAC name is 3-(cyclopentylamino)-N-[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-4-methyl-1H-pyrrol-3-yl]propanamide.
| Compound Name | 3-(cyclopentylamino)-N-[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-4-methyl-1H-pyrrol-3-yl]propanamide |
|---|---|
| PubChem CID | 156632963 |
| Molecular Formula | C22H25FN4O2 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 3-(cyclopentylamino)-N-[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-4-methyl-1H-pyrrol-3-yl]propanamide |
| SMILES | Cc1c(NC(=O)CCNC2CCCC2)c[nH]c1/C=C1\C(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C22H25FN4O2/c1-13-19(11-17-16-10-14(23)6-7-18(16)27-22(17)29)25-12-20(13)26-21(28)8-9-24-15-4-2-3-5-15/h6-7,10-12,15,24-25H,2-5,8-9H2,1H3,(H,26,28)(H,27,29)/b17-11- |
| InChIKey | QNUXENPCOUONPJ-BOPFTXTBSA-N |
| XLogP | 3.82 |
| TPSA | 86.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|