C3H6N6O4 — CID 156633046
2-N,2-N,4-N,4-N-tetrahydroxy-1,3,5-triazine-2,4,6-triamine (PubChem CID 156633046) has the molecular formula C3H6N6O4 and a molecular weight of 190.12 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N-tetrahydroxy-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,4-N,4-N-tetrahydroxy-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 156633046 |
| Molecular Formula | C3H6N6O4 |
| Molecular Weight | 190.12 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 2-N,2-N,4-N,4-N-tetrahydroxy-1,3,5-triazine-2,4,6-triamine |
| SMILES | Nc1nc(N(O)O)nc(N(O)O)n1 |
| InChI | InChI=1S/C3H6N6O4/c4-1-5-2(8(10)11)7-3(6-1)9(12)13/h10-13H,(H2,4,5,6,7) |
| InChIKey | JJUKXBIXADJCQC-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 152.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.12 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|