C21H21NO4 — CID 156633500
2-[cyclobutyl-[deuterio(9H-fluoren-9-yl)methoxy]carbonylamino]acetic acid (PubChem CID 156633500) has the molecular formula C21H21NO4 and a molecular weight of 352.41 g/mol. Its IUPAC name is 2-[cyclobutyl-[deuterio(9H-fluoren-9-yl)methoxy]carbonylamino]acetic acid.
| Compound Name | 2-[cyclobutyl-[deuterio(9H-fluoren-9-yl)methoxy]carbonylamino]acetic acid |
|---|---|
| PubChem CID | 156633500 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-[cyclobutyl-[deuterio(9H-fluoren-9-yl)methoxy]carbonylamino]acetic acid |
| SMILES | [2H]C(OC(=O)N(CC(=O)O)C1CCC1)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H21NO4/c23-20(24)12-22(14-6-5-7-14)21(25)26-13-19-17-10-3-1-8-15(17)16-9-2-4-11-18(16)19/h1-4,8-11,14,19H,5-7,12-13H2,(H,23,24)/i13D |
| InChIKey | VFDBMOREDMHPMN-YSOHJTORSA-N |
| XLogP | 3.87 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |