C34H44N2O7 — CID 156633858
trans-tert-butyl (1R,2R)-4-[2-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-pyridinyl]ethynyl]-4-hydroxy-2-phenylcyclohexane-1-carboxylate (PubChem CID 156633858) has the molecular formula C34H44N2O7 and a molecular weight of 592.73 g/mol. Its IUPAC name is trans-tert-butyl (1R,2R)-4-[2-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-pyridinyl]ethynyl]-4-hydroxy-2-phenylcyclohexane-1-carboxylate.
| Compound Name | trans-tert-butyl (1R,2R)-4-[2-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-pyridinyl]ethynyl]-4-hydroxy-2-phenylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 156633858 |
| Molecular Formula | C34H44N2O7 |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.31 |
| IUPAC Name | trans-tert-butyl (1R,2R)-4-[2-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-pyridinyl]ethynyl]-4-hydroxy-2-phenylcyclohexane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCC(O)(C#Cc2cccc(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)n2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C34H44N2O7/c1-31(2,3)41-28(37)25-19-21-34(40,22-26(25)23-14-11-10-12-15-23)20-18-24-16-13-17-27(35-24)36(29(38)42-32(4,5)6)30(39)43-33(7,8)9/h10-17,25-26,40H,19,21-22H2,1-9H3/t25-,26+,34?/m1/s1 |
| InChIKey | HELCPEJCHZHAHU-KYRJCYJHSA-N |
| XLogP | 6.77 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|