C46H29N3S2 — CID 156634449
1-[7-(2,6-diphenylpyrimidin-4-yl)thianthren-2-yl]-9-phenylcarbazole (PubChem CID 156634449) has the molecular formula C46H29N3S2 and a molecular weight of 687.89 g/mol. Its IUPAC name is 1-[7-(2,6-diphenylpyrimidin-4-yl)thianthren-2-yl]-9-phenylcarbazole.
| Compound Name | 1-[7-(2,6-diphenylpyrimidin-4-yl)thianthren-2-yl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 156634449 |
| Molecular Formula | C46H29N3S2 |
| Molecular Weight | 687.89 g/mol |
| Exact Mass | 687.18 |
| IUPAC Name | 1-[7-(2,6-diphenylpyrimidin-4-yl)thianthren-2-yl]-9-phenylcarbazole |
| SMILES | c1ccc(-c2cc(-c3ccc4c(c3)Sc3ccc(-c5cccc6c7ccccc7n(-c7ccccc7)c56)cc3S4)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C46H29N3S2/c1-4-13-30(14-5-1)38-29-39(48-46(47-38)31-15-6-2-7-16-31)33-24-26-42-44(28-33)51-41-25-23-32(27-43(41)50-42)35-20-12-21-37-36-19-10-11-22-40(36)49(45(35)37)34-17-8-3-9-18-34/h1-29H |
| InChIKey | ZJTLYRRSMDQANZ-UHFFFAOYSA-N |
| XLogP | 12.86 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.89 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |