About 2-(2,3-dihydro-1H-pyrrolo[3,4-c]quinolin-1-yl)propan-2-yl acetate
2-(2,3-dihydro-1H-pyrrolo[3,4-c]quinolin-1-yl)propan-2-yl acetate (PubChem CID 156634569) has the molecular formula C16H18N2O2
and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-pyrrolo[3,4-c]quinolin-1-yl)propan-2-yl acetate.
Molecular Properties
| Compound Name | 2-(2,3-dihydro-1H-pyrrolo[3,4-c]quinolin-1-yl)propan-2-yl acetate |
| PubChem CID | 156634569 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-(2,3-dihydro-1H-pyrrolo[3,4-c]quinolin-1-yl)propan-2-yl acetate |
| SMILES | CC(=O)OC(C)(C)C1NCc2cnc3ccccc3c21 |
| InChI | InChI=1S/C16H18N2O2/c1-10(19)20-16(2,3)15-14-11(9-18-15)8-17-13-7-5-4-6-12(13)14/h4-8,15,18H,9H2,1-3H3 |
| InChIKey | WNONTVKJQJSDAW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,3-dihydro-1H-pyrrolo[3,4-c]quinolin-1-yl)propan-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydro-1H-pyrrolo[3,4-c]quinolin-1-yl)propan-2-yl acetate?
The IUPAC name of 2-(2,3-dihydro-1H-pyrrolo[3,4-c]quinolin-1-yl)propan-2-yl acetate (CID 156634569) is 2-(2,3-dihydro-1H-pyrrolo[3,4-c]quinolin-1-yl)propan-2-yl acetate.
What is the SMILES notation for 2-(2,3-dihydro-1H-pyrrolo[3,4-c]quinolin-1-yl)propan-2-yl acetate?
The canonical SMILES for 2-(2,3-dihydro-1H-pyrrolo[3,4-c]quinolin-1-yl)propan-2-yl acetate is CC(=O)OC(C)(C)C1NCc2cnc3ccccc3c21.
What is the InChIKey of 2-(2,3-dihydro-1H-pyrrolo[3,4-c]quinolin-1-yl)propan-2-yl acetate?
The InChIKey is WNONTVKJQJSDAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2/c1-10(19)20-16(2,3)15-14-11(9-18-15)8-17-13-7-5-4-6-12(13)14/h4-8,15,18H,9H2,1-3H3.
What are the key properties of 2-(2,3-dihydro-1H-pyrrolo[3,4-c]quinolin-1-yl)propan-2-yl acetate?
2-(2,3-dihydro-1H-pyrrolo[3,4-c]quinolin-1-yl)propan-2-yl acetate has a molecular weight of 270.33 g/mol, XLogP of 2.72, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydro-1H-pyrrolo[3,4-c]quinolin-1-yl)propan-2-yl acetate is sourced from PubChem (CID 156634569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).