C24H44O6 — CID 15663484
(3R,5R)-7-[(1S,2S,3R,6S)-2-(2,2-dimethylbutanoyloxymethyl)-6-methyl-3-propylcyclohexyl]-3,5-dihydroxyheptanoic acid (PubChem CID 15663484) has the molecular formula C24H44O6 and a molecular weight of 428.61 g/mol. Its IUPAC name is (3R,5R)-7-[(1S,2S,3R,6S)-2-(2,2-dimethylbutanoyloxymethyl)-6-methyl-3-propylcyclohexyl]-3,5-dihydroxyheptanoic acid.
| Compound Name | (3R,5R)-7-[(1S,2S,3R,6S)-2-(2,2-dimethylbutanoyloxymethyl)-6-methyl-3-propylcyclohexyl]-3,5-dihydroxyheptanoic acid |
|---|---|
| PubChem CID | 15663484 |
| Molecular Formula | C24H44O6 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | (3R,5R)-7-[(1S,2S,3R,6S)-2-(2,2-dimethylbutanoyloxymethyl)-6-methyl-3-propylcyclohexyl]-3,5-dihydroxyheptanoic acid |
| SMILES | CCC[C@@H]1CC[C@H](C)[C@H](CC[C@@H](O)C[C@@H](O)CC(=O)O)[C@H]1COC(=O)C(C)(C)CC |
| InChI | InChI=1S/C24H44O6/c1-6-8-17-10-9-16(3)20(12-11-18(25)13-19(26)14-22(27)28)21(17)15-30-23(29)24(4,5)7-2/h16-21,25-26H,6-15H2,1-5H3,(H,27,28)/t16-,17+,18+,19+,20-,21-/m0/s1 |
| InChIKey | OCFSRHVZSAWNAA-LPYKTLRWSA-N |
| XLogP | 4.41 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |