About 3-[[3-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl]methyl]phenol
3-[[3-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl]methyl]phenol (PubChem CID 156634969) has the molecular formula C18H16FN3O
and a molecular weight of 309.34 g/mol. Its IUPAC name is 3-[[3-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl]methyl]phenol.
Molecular Properties
| Compound Name | 3-[[3-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl]methyl]phenol |
| PubChem CID | 156634969 |
| Molecular Formula | C18H16FN3O |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 3-[[3-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl]methyl]phenol |
| SMILES | Oc1cccc(Cn2nc3c(c2-c2ccccc2F)CNC3)c1 |
| InChI | InChI=1S/C18H16FN3O/c19-16-7-2-1-6-14(16)18-15-9-20-10-17(15)21-22(18)11-12-4-3-5-13(23)8-12/h1-8,20,23H,9-11H2 |
| InChIKey | ZHHDUUDGSFKFJD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[3-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl]methyl]phenol?
The IUPAC name of 3-[[3-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl]methyl]phenol (CID 156634969) is 3-[[3-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl]methyl]phenol.
What is the SMILES notation for 3-[[3-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl]methyl]phenol?
The canonical SMILES for 3-[[3-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl]methyl]phenol is Oc1cccc(Cn2nc3c(c2-c2ccccc2F)CNC3)c1.
What is the InChIKey of 3-[[3-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl]methyl]phenol?
The InChIKey is ZHHDUUDGSFKFJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16FN3O/c19-16-7-2-1-6-14(16)18-15-9-20-10-17(15)21-22(18)11-12-4-3-5-13(23)8-12/h1-8,20,23H,9-11H2.
What are the key properties of 3-[[3-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl]methyl]phenol?
3-[[3-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl]methyl]phenol has a molecular weight of 309.34 g/mol, XLogP of 3.05, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-(2-fluorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-yl]methyl]phenol is sourced from PubChem (CID 156634969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).