C16H20F3N3O6S2 — CID 156635025
tert-butyl 2-methylsulfanyl-4-(trifluoromethylsulfonyloxy)spiro[6,8-dihydropyrido[3,4-d]pyrimidine-5,3'-oxetane]-7-carboxylate (PubChem CID 156635025) has the molecular formula C16H20F3N3O6S2 and a molecular weight of 471.48 g/mol. Its IUPAC name is tert-butyl 2-methylsulfanyl-4-(trifluoromethylsulfonyloxy)spiro[6,8-dihydropyrido[3,4-d]pyrimidine-5,3'-oxetane]-7-carboxylate.
| Compound Name | tert-butyl 2-methylsulfanyl-4-(trifluoromethylsulfonyloxy)spiro[6,8-dihydropyrido[3,4-d]pyrimidine-5,3'-oxetane]-7-carboxylate |
|---|---|
| PubChem CID | 156635025 |
| Molecular Formula | C16H20F3N3O6S2 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | tert-butyl 2-methylsulfanyl-4-(trifluoromethylsulfonyloxy)spiro[6,8-dihydropyrido[3,4-d]pyrimidine-5,3'-oxetane]-7-carboxylate |
| SMILES | CSc1nc2c(c(OS(=O)(=O)C(F)(F)F)n1)C1(COC1)CN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C16H20F3N3O6S2/c1-14(2,3)27-13(23)22-5-9-10(15(6-22)7-26-8-15)11(21-12(20-9)29-4)28-30(24,25)16(17,18)19/h5-8H2,1-4H3 |
| InChIKey | OBWGYRJFXIHQDV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 107.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|