C20H24N6O3 — CID 156635533
2-amino-5-(2-methoxyethoxy)-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]benzamide (PubChem CID 156635533) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is 2-amino-5-(2-methoxyethoxy)-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]benzamide.
| Compound Name | 2-amino-5-(2-methoxyethoxy)-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 156635533 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 2-amino-5-(2-methoxyethoxy)-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]benzamide |
| SMILES | COCCOc1ccc(N)c(C(=O)Nc2cccc(-c3nncn3C(C)C)n2)c1 |
| InChI | InChI=1S/C20H24N6O3/c1-13(2)26-12-22-25-19(26)17-5-4-6-18(23-17)24-20(27)15-11-14(7-8-16(15)21)29-10-9-28-3/h4-8,11-13H,9-10,21H2,1-3H3,(H,23,24,27) |
| InChIKey | VQHPAAPUYXVIMQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|