C19H40N2O3 — CID 156635641
bis(1,1,3,5-tetramethylpiperidin-1-ium);carbonate (PubChem CID 156635641) has the molecular formula C19H40N2O3 and a molecular weight of 344.54 g/mol. Its IUPAC name is bis(1,1,3,5-tetramethylpiperidin-1-ium);carbonate.
| Compound Name | bis(1,1,3,5-tetramethylpiperidin-1-ium);carbonate |
|---|---|
| PubChem CID | 156635641 |
| Molecular Formula | C19H40N2O3 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.30 |
| IUPAC Name | bis(1,1,3,5-tetramethylpiperidin-1-ium);carbonate |
| SMILES | CC1CC(C)C[N+](C)(C)C1.CC1CC(C)C[N+](C)(C)C1.O=C([O-])[O-] |
| InChI | InChI=1S/2C9H20N.CH2O3/c2*1-8-5-9(2)7-10(3,4)6-8;2-1(3)4/h2*8-9H,5-7H2,1-4H3;(H2,2,3,4)/q2*+1;/p-2 |
| InChIKey | UZGHPGAFEGKKJU-UHFFFAOYSA-L |
| XLogP | 1.03 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|