C14H22N2O4 — CID 156635722
tert-butyl 2-[[6-[2-hydroxyethyl(methyl)amino]-2-pyridinyl]oxy]acetate (PubChem CID 156635722) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is tert-butyl 2-[[6-[2-hydroxyethyl(methyl)amino]-2-pyridinyl]oxy]acetate.
| Compound Name | tert-butyl 2-[[6-[2-hydroxyethyl(methyl)amino]-2-pyridinyl]oxy]acetate |
|---|---|
| PubChem CID | 156635722 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | tert-butyl 2-[[6-[2-hydroxyethyl(methyl)amino]-2-pyridinyl]oxy]acetate |
| SMILES | CN(CCO)c1cccc(OCC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C14H22N2O4/c1-14(2,3)20-13(18)10-19-12-7-5-6-11(15-12)16(4)8-9-17/h5-7,17H,8-10H2,1-4H3 |
| InChIKey | MHZAHVCXRQJMIG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |