C26H21F2N5O6S2 — CID 156635798
5-fluoro-N-(2-fluoro-3-methylsulfonylphenyl)-4-[1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonyl-7-nitroindol-3-yl]pyrimidin-2-amine (PubChem CID 156635798) has the molecular formula C26H21F2N5O6S2 and a molecular weight of 601.61 g/mol. Its IUPAC name is 5-fluoro-N-(2-fluoro-3-methylsulfonylphenyl)-4-[1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonyl-7-nitroindol-3-yl]pyrimidin-2-amine.
| Compound Name | 5-fluoro-N-(2-fluoro-3-methylsulfonylphenyl)-4-[1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonyl-7-nitroindol-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 156635798 |
| Molecular Formula | C26H21F2N5O6S2 |
| Molecular Weight | 601.61 g/mol |
| Exact Mass | 601.09 |
| IUPAC Name | 5-fluoro-N-(2-fluoro-3-methylsulfonylphenyl)-4-[1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonyl-7-nitroindol-3-yl]pyrimidin-2-amine |
| SMILES | CC1(S(=O)(=O)n2cc(-c3nc(Nc4cccc(S(C)(=O)=O)c4F)ncc3F)c3cccc([N+](=O)[O-])c32)C=CC=CC1 |
| InChI | InChI=1S/C26H21F2N5O6S2/c1-26(12-4-3-5-13-26)41(38,39)32-15-17(16-8-6-10-20(24(16)32)33(34)35)23-18(27)14-29-25(31-23)30-19-9-7-11-21(22(19)28)40(2,36)37/h3-12,14-15H,13H2,1-2H3,(H,29,30,31) |
| InChIKey | CDUJCIBPRFEZEB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 154.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.61 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|