C20H16N4O5S3 — CID 156636184
5-methyl-6-methylsulfonyl-8-nitro-2-[(2-phenyl-1,3-thiazol-4-yl)methylamino]-1,3-benzothiazin-4-one (PubChem CID 156636184) has the molecular formula C20H16N4O5S3 and a molecular weight of 488.57 g/mol. Its IUPAC name is 5-methyl-6-methylsulfonyl-8-nitro-2-[(2-phenyl-1,3-thiazol-4-yl)methylamino]-1,3-benzothiazin-4-one.
| Compound Name | 5-methyl-6-methylsulfonyl-8-nitro-2-[(2-phenyl-1,3-thiazol-4-yl)methylamino]-1,3-benzothiazin-4-one |
|---|---|
| PubChem CID | 156636184 |
| Molecular Formula | C20H16N4O5S3 |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | 5-methyl-6-methylsulfonyl-8-nitro-2-[(2-phenyl-1,3-thiazol-4-yl)methylamino]-1,3-benzothiazin-4-one |
| SMILES | Cc1c(S(C)(=O)=O)cc([N+](=O)[O-])c2sc(NCc3csc(-c4ccccc4)n3)nc(=O)c12 |
| InChI | InChI=1S/C20H16N4O5S3/c1-11-15(32(2,28)29)8-14(24(26)27)17-16(11)18(25)23-20(31-17)21-9-13-10-30-19(22-13)12-6-4-3-5-7-12/h3-8,10H,9H2,1-2H3,(H,21,23,25) |
| InChIKey | JVNDWDCPBRWSRO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|