C9H13Br2N — CID 15663627
5-(2,2-dibromoethenyl)-1-azabicyclo[3.2.1]octane (PubChem CID 15663627) has the molecular formula C9H13Br2N and a molecular weight of 295.02 g/mol. Its IUPAC name is 5-(2,2-dibromoethenyl)-1-azabicyclo[3.2.1]octane.
| Compound Name | 5-(2,2-dibromoethenyl)-1-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 15663627 |
| Molecular Formula | C9H13Br2N |
| Molecular Weight | 295.02 g/mol |
| Exact Mass | 292.94 |
| IUPAC Name | 5-(2,2-dibromoethenyl)-1-azabicyclo[3.2.1]octane |
| SMILES | BrC(Br)=CC12CCCN(CC1)C2 |
| InChI | InChI=1S/C9H13Br2N/c10-8(11)6-9-2-1-4-12(7-9)5-3-9/h6H,1-5,7H2 |
| InChIKey | BVCNAIUFIAANLF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.02 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |