C22H21F3N3O4PS — CID 156637311
N-[2,6-difluoro-4-(2-phenylethynyl)phenyl]-1,3-dimethylpyrazole-4-sulfonamide;2-fluoro-2-phosphanylpropanoic acid (PubChem CID 156637311) has the molecular formula C22H21F3N3O4PS and a molecular weight of 511.46 g/mol. Its IUPAC name is N-[2,6-difluoro-4-(2-phenylethynyl)phenyl]-1,3-dimethylpyrazole-4-sulfonamide;2-fluoro-2-phosphanylpropanoic acid.
| Compound Name | N-[2,6-difluoro-4-(2-phenylethynyl)phenyl]-1,3-dimethylpyrazole-4-sulfonamide;2-fluoro-2-phosphanylpropanoic acid |
|---|---|
| PubChem CID | 156637311 |
| Molecular Formula | C22H21F3N3O4PS |
| Molecular Weight | 511.46 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | N-[2,6-difluoro-4-(2-phenylethynyl)phenyl]-1,3-dimethylpyrazole-4-sulfonamide;2-fluoro-2-phosphanylpropanoic acid |
| SMILES | CC(F)(P)C(=O)O.Cc1nn(C)cc1S(=O)(=O)Nc1c(F)cc(C#Cc2ccccc2)cc1F |
| InChI | InChI=1S/C19H15F2N3O2S.C3H6FO2P/c1-13-18(12-24(2)22-13)27(25,26)23-19-16(20)10-15(11-17(19)21)9-8-14-6-4-3-5-7-14;1-3(4,7)2(5)6/h3-7,10-12,23H,1-2H3;7H2,1H3,(H,5,6) |
| InChIKey | ZZBSIZJZPRILKS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|