C14H23F2NO — CID 156637338
4-(2,6-difluorophenyl)morpholine;ethane (PubChem CID 156637338) has the molecular formula C14H23F2NO and a molecular weight of 259.34 g/mol. Its IUPAC name is 4-(2,6-difluorophenyl)morpholine;ethane.
| Compound Name | 4-(2,6-difluorophenyl)morpholine;ethane |
|---|---|
| PubChem CID | 156637338 |
| Molecular Formula | C14H23F2NO |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 4-(2,6-difluorophenyl)morpholine;ethane |
| SMILES | CC.CC.Fc1cccc(F)c1N1CCOCC1 |
| InChI | InChI=1S/C10H11F2NO.2C2H6/c11-8-2-1-3-9(12)10(8)13-4-6-14-7-5-13;2*1-2/h1-3H,4-7H2;2*1-2H3 |
| InChIKey | KKLDOBFNZLHTKT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |