C15H25N — CID 156637596
7,8-dimethyl-3-propan-2-yl-1,2,4,5,8,9-hexahydro-3-benzazepine (PubChem CID 156637596) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 7,8-dimethyl-3-propan-2-yl-1,2,4,5,8,9-hexahydro-3-benzazepine.
| Compound Name | 7,8-dimethyl-3-propan-2-yl-1,2,4,5,8,9-hexahydro-3-benzazepine |
|---|---|
| PubChem CID | 156637596 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 7,8-dimethyl-3-propan-2-yl-1,2,4,5,8,9-hexahydro-3-benzazepine |
| SMILES | CC1=CC2=C(CCN(C(C)C)CC2)CC1C |
| InChI | InChI=1S/C15H25N/c1-11(2)16-7-5-14-9-12(3)13(4)10-15(14)6-8-16/h9,11,13H,5-8,10H2,1-4H3 |
| InChIKey | CIOXFCKXVJJALE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |