C13H25N3 — CID 156637625
2-butyl-5,7,7-trimethyl-1,2,4,6-tetrahydropyrazolo[1,5-a]pyrazine (PubChem CID 156637625) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is 2-butyl-5,7,7-trimethyl-1,2,4,6-tetrahydropyrazolo[1,5-a]pyrazine.
| Compound Name | 2-butyl-5,7,7-trimethyl-1,2,4,6-tetrahydropyrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 156637625 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 2-butyl-5,7,7-trimethyl-1,2,4,6-tetrahydropyrazolo[1,5-a]pyrazine |
| SMILES | CCCCC1C=C2CN(C)CC(C)(C)N2N1 |
| InChI | InChI=1S/C13H25N3/c1-5-6-7-11-8-12-9-15(4)10-13(2,3)16(12)14-11/h8,11,14H,5-7,9-10H2,1-4H3 |
| InChIKey | ZZQUWANFAUUQOF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |